C24H35FN3O7P — CID 90798655
[2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate (PubChem CID 90798655) has the molecular formula C24H35FN3O7P and a molecular weight of 527.53 g/mol. Its IUPAC name is [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate.
| Compound Name | [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90798655 |
| Molecular Formula | C24H35FN3O7P |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | [2-[3-[4-(5-fluoro-2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-5-yl] dihydrogen phosphate |
| SMILES | CC(C)Oc1ccc(F)cc1N1CCN(CCCn2c(O)c3c(c2O)CC(OP(=O)(O)O)CC3)CC1 |
| InChI | InChI=1S/C24H35FN3O7P/c1-16(2)34-22-7-4-17(25)14-21(22)27-12-10-26(11-13-27)8-3-9-28-23(29)19-6-5-18(35-36(31,32)33)15-20(19)24(28)30/h4,7,14,16,18,29-30H,3,5-6,8-13,15H2,1-2H3,(H2,31,32,33) |
| InChIKey | JDFKYEVFXGTZCY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|