C21H24N4O — CID 90798818
3-[[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90798818) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-[[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90798818 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 3-[[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | CN(C)C1CCN(c2ccc(/N=C/C3C(=O)Nc4ccccc43)cc2)C1 |
| InChI | InChI=1S/C21H24N4O/c1-24(2)17-11-12-25(14-17)16-9-7-15(8-10-16)22-13-19-18-5-3-4-6-20(18)23-21(19)26/h3-10,13,17,19H,11-12,14H2,1-2H3,(H,23,26)/b22-13+ |
| InChIKey | JYZKFZRSHFQGBM-LPYMAVHISA-N |
| XLogP | 3.27 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|