About 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane
4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane (PubChem CID 90799203) has the molecular formula C14H26N2O5
and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane.
Molecular Properties
| Compound Name | 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane |
| PubChem CID | 90799203 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane |
| SMILES | CC.CCC.O=C(O)CCC(=O)NCN1C(=O)CCC1=O |
| InChI | InChI=1S/C9H12N2O5.C3H8.C2H6/c12-6(1-4-9(15)16)10-5-11-7(13)2-3-8(11)14;1-3-2;1-2/h1-5H2,(H,10,12)(H,15,16);3H2,1-2H3;1-2H3 |
| InChIKey | CKSCOKHNJUHFHX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane?
The IUPAC name of 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane (CID 90799203) is 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane.
What is the SMILES notation for 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane?
The canonical SMILES for 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane is CC.CCC.O=C(O)CCC(=O)NCN1C(=O)CCC1=O.
What is the InChIKey of 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane?
The InChIKey is CKSCOKHNJUHFHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O5.C3H8.C2H6/c12-6(1-4-9(15)16)10-5-11-7(13)2-3-8(11)14;1-3-2;1-2/h1-5H2,(H,10,12)(H,15,16);3H2,1-2H3;1-2H3.
What are the key properties of 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane?
4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane has a molecular weight of 302.37 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dioxopyrrolidin-1-yl)methylamino]-4-oxobutanoic acid;ethane;propane is sourced from PubChem (CID 90799203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).