About 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol
2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol (PubChem CID 90799854) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol |
| PubChem CID | 90799854 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol |
| SMILES | CC(O)C1SC=CC1O |
| InChI | InChI=1S/C6H10O2S/c1-4(7)6-5(8)2-3-9-6/h2-8H,1H3 |
| InChIKey | LXHOUYAFSMPJFB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol?
The IUPAC name of 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol (CID 90799854) is 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol.
What is the SMILES notation for 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol?
The canonical SMILES for 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol is CC(O)C1SC=CC1O.
What is the InChIKey of 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol?
The InChIKey is LXHOUYAFSMPJFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-4(7)6-5(8)2-3-9-6/h2-8H,1H3.
What are the key properties of 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol?
2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol has a molecular weight of 146.21 g/mol, XLogP of 0.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)-2,3-dihydrothiophen-3-ol is sourced from PubChem (CID 90799854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).