About 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine
4-(4-methoxyhexa-2,4-dien-3-yl)morpholine (PubChem CID 90799986) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine.
Molecular Properties
| Compound Name | 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine |
| PubChem CID | 90799986 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine |
| SMILES | CC=C(OC)C(=CC)N1CCOCC1 |
| InChI | InChI=1S/C11H19NO2/c1-4-10(11(5-2)13-3)12-6-8-14-9-7-12/h4-5H,6-9H2,1-3H3 |
| InChIKey | FZFHXQTUNJQAKZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine?
The IUPAC name of 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine (CID 90799986) is 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine.
What is the SMILES notation for 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine?
The canonical SMILES for 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine is CC=C(OC)C(=CC)N1CCOCC1.
What is the InChIKey of 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine?
The InChIKey is FZFHXQTUNJQAKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-10(11(5-2)13-3)12-6-8-14-9-7-12/h4-5H,6-9H2,1-3H3.
What are the key properties of 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine?
4-(4-methoxyhexa-2,4-dien-3-yl)morpholine has a molecular weight of 197.28 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyhexa-2,4-dien-3-yl)morpholine is sourced from PubChem (CID 90799986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).