C35H48N2O4 — CID 90800312
tert-butylbenzene;2,2-dimethylpropane;6-methyl-2-(2-phenylpropan-2-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 90800312) has the molecular formula C35H48N2O4 and a molecular weight of 560.78 g/mol. Its IUPAC name is tert-butylbenzene;2,2-dimethylpropane;6-methyl-2-(2-phenylpropan-2-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | tert-butylbenzene;2,2-dimethylpropane;6-methyl-2-(2-phenylpropan-2-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 90800312 |
| Molecular Formula | C35H48N2O4 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | tert-butylbenzene;2,2-dimethylpropane;6-methyl-2-(2-phenylpropan-2-yl)-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC(C)(C)C.CC(C)(C)c1ccccc1.CN1C(=O)C2CC3C(=O)N(C(C)(C)c4ccccc4)C(=O)C3CC2C1=O |
| InChI | InChI=1S/C20H22N2O4.C10H14.C5H12/c1-20(2,11-7-5-4-6-8-11)22-18(25)14-9-12-13(10-15(14)19(22)26)17(24)21(3)16(12)23;1-10(2,3)9-7-5-4-6-8-9;1-5(2,3)4/h4-8,12-15H,9-10H2,1-3H3;4-8H,1-3H3;1-4H3 |
| InChIKey | FQDDDGOEIXJUBN-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|