C22H30N4O2 — CID 90800451
1-[2-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxymethyl]phenyl]methoxy]ethyl]-3,5-dimethylpyrazole (PubChem CID 90800451) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[2-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxymethyl]phenyl]methoxy]ethyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[2-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxymethyl]phenyl]methoxy]ethyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 90800451 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[2-[[4-[2-(3,5-dimethylpyrazol-1-yl)ethoxymethyl]phenyl]methoxy]ethyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(CCOCc2ccc(COCCn3nc(C)cc3C)cc2)n1 |
| InChI | InChI=1S/C22H30N4O2/c1-17-13-19(3)25(23-17)9-11-27-15-21-5-7-22(8-6-21)16-28-12-10-26-20(4)14-18(2)24-26/h5-8,13-14H,9-12,15-16H2,1-4H3 |
| InChIKey | OMWVLTNKIDXZGL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|