C46H54N6OS — CID 90800474
S-[4-[10,20-diheptyl-15-(1-methylimidazol-2-yl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] ethanethioate (PubChem CID 90800474) has the molecular formula C46H54N6OS and a molecular weight of 739.05 g/mol. Its IUPAC name is S-[4-[10,20-diheptyl-15-(1-methylimidazol-2-yl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] ethanethioate.
| Compound Name | S-[4-[10,20-diheptyl-15-(1-methylimidazol-2-yl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 90800474 |
| Molecular Formula | C46H54N6OS |
| Molecular Weight | 739.05 g/mol |
| Exact Mass | 738.41 |
| IUPAC Name | S-[4-[10,20-diheptyl-15-(1-methylimidazol-2-yl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenyl] ethanethioate |
| SMILES | CCCCCCCC1=c2ccc([nH]2)=C(c2ccc(SC(C)=O)cc2)c2ccc([nH]2)C(CCCCCCC)=c2ccc([nH]2)=C(c2nccn2C)c2ccc1[nH]2 |
| InChI | InChI=1S/C46H54N6OS/c1-5-7-9-11-13-15-34-36-21-25-40(48-36)44(32-17-19-33(20-18-32)54-31(3)53)41-26-22-37(49-41)35(16-14-12-10-8-6-2)39-24-28-43(51-39)45(42-27-23-38(34)50-42)46-47-29-30-52(46)4/h17-30,48-51H,5-16H2,1-4H3 |
| InChIKey | NOGIFQCUKLMOGF-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.05 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|