C12H10F9NO6S — CID 90800565
(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate (PubChem CID 90800565) has the molecular formula C12H10F9NO6S and a molecular weight of 467.26 g/mol. Its IUPAC name is (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate.
| Compound Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 90800565 |
| Molecular Formula | C12H10F9NO6S |
| Molecular Weight | 467.26 g/mol |
| Exact Mass | 467.01 |
| IUPAC Name | (1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl) 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonate |
| SMILES | O=S(=O)(On1c(O)c2c(c1O)CCCC2)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F9NO6S/c13-9(14,15)10(16,17)27-11(18,19)12(20,21)29(25,26)28-22-7(23)5-3-1-2-4-6(5)8(22)24/h23-24H,1-4H2 |
| InChIKey | IQAMYWPQTFEICB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|