About 5-but-1-enyl-1,3-dihydropyrrol-2-one
5-but-1-enyl-1,3-dihydropyrrol-2-one (PubChem CID 90800647) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 5-but-1-enyl-1,3-dihydropyrrol-2-one.
Molecular Properties
| Compound Name | 5-but-1-enyl-1,3-dihydropyrrol-2-one |
| PubChem CID | 90800647 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 5-but-1-enyl-1,3-dihydropyrrol-2-one |
| SMILES | CCC=CC1=CCC(=O)N1 |
| InChI | InChI=1S/C8H11NO/c1-2-3-4-7-5-6-8(10)9-7/h3-5H,2,6H2,1H3,(H,9,10) |
| InChIKey | WQRVKNSYZXAGKX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-but-1-enyl-1,3-dihydropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-1-enyl-1,3-dihydropyrrol-2-one?
The IUPAC name of 5-but-1-enyl-1,3-dihydropyrrol-2-one (CID 90800647) is 5-but-1-enyl-1,3-dihydropyrrol-2-one.
What is the SMILES notation for 5-but-1-enyl-1,3-dihydropyrrol-2-one?
The canonical SMILES for 5-but-1-enyl-1,3-dihydropyrrol-2-one is CCC=CC1=CCC(=O)N1.
What is the InChIKey of 5-but-1-enyl-1,3-dihydropyrrol-2-one?
The InChIKey is WQRVKNSYZXAGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-2-3-4-7-5-6-8(10)9-7/h3-5H,2,6H2,1H3,(H,9,10).
What are the key properties of 5-but-1-enyl-1,3-dihydropyrrol-2-one?
5-but-1-enyl-1,3-dihydropyrrol-2-one has a molecular weight of 137.18 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-1-enyl-1,3-dihydropyrrol-2-one is sourced from PubChem (CID 90800647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).