C29H22ClN3O5 — CID 90800777
4-[(4R,7R)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile (PubChem CID 90800777) has the molecular formula C29H22ClN3O5 and a molecular weight of 527.96 g/mol. Its IUPAC name is 4-[(4R,7R)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[(4R,7R)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 90800777 |
| Molecular Formula | C29H22ClN3O5 |
| Molecular Weight | 527.96 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-[(4R,7R)-4-[2-[(5-chloro-1,2-benzoxazol-3-yl)oxy]ethyl]-1,3-dihydroxy-7-methyl-5,6-dihydro-4,7-epoxyisoindol-2-yl]naphthalene-1-carbonitrile |
| SMILES | C[C@]12CC[C@](CCOc3noc4ccc(Cl)cc34)(O1)c1c2c(O)n(-c2ccc(C#N)c3ccccc23)c1O |
| InChI | InChI=1S/C29H22ClN3O5/c1-28-10-11-29(38-28,12-13-36-25-20-14-17(30)7-9-22(20)37-32-25)24-23(28)26(34)33(27(24)35)21-8-6-16(15-31)18-4-2-3-5-19(18)21/h2-9,14,34-35H,10-13H2,1H3/t28-,29-/m1/s1 |
| InChIKey | ILRWQEJUTOTXBZ-FQLXRVMXSA-N |
| XLogP | 6.41 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.96 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |