About 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine
2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine (PubChem CID 90800918) has the molecular formula C16H21N5O2
and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine.
Molecular Properties
| Compound Name | 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine |
| PubChem CID | 90800918 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine |
| SMILES | CC.CN.Nc1nc2c(Oc3ccccc3)ccnc2[nH]c1=O |
| InChI | InChI=1S/C13H10N4O2.C2H6.CH5N/c14-11-13(18)17-12-10(16-11)9(6-7-15-12)19-8-4-2-1-3-5-8;2*1-2/h1-7H,(H2,14,16)(H,15,17,18);1-2H3;2H2,1H3 |
| InChIKey | WNTSELWRGXVVDH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine?
The IUPAC name of 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine (CID 90800918) is 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine.
What is the SMILES notation for 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine?
The canonical SMILES for 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine is CC.CN.Nc1nc2c(Oc3ccccc3)ccnc2[nH]c1=O.
What is the InChIKey of 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine?
The InChIKey is WNTSELWRGXVVDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2.C2H6.CH5N/c14-11-13(18)17-12-10(16-11)9(6-7-15-12)19-8-4-2-1-3-5-8;2*1-2/h1-7H,(H2,14,16)(H,15,17,18);1-2H3;2H2,1H3.
What are the key properties of 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine?
2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine has a molecular weight of 315.38 g/mol, XLogP of 2.29, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-phenoxy-4H-pyrido[2,3-b]pyrazin-3-one;ethane;methanamine is sourced from PubChem (CID 90800918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).