C10H30O6Si5 — CID 90801151
(2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl)methanol (PubChem CID 90801151) has the molecular formula C10H30O6Si5 and a molecular weight of 386.77 g/mol. Its IUPAC name is (2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl)methanol.
| Compound Name | (2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl)methanol |
|---|---|
| PubChem CID | 90801151 |
| Molecular Formula | C10H30O6Si5 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (2,4,4,6,6,8,8,10,10-nonamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl)methanol |
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(CO)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H30O6Si5/c1-17(2)12-18(3,4)14-20(7,8)16-21(9,10-11)15-19(5,6)13-17/h11H,10H2,1-9H3 |
| InChIKey | BTCVOERMPVARKI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|