C10H11NO2S — CID 9080124
5-acetyl-N-cyclopropylthiophene-2-carboxamide (PubChem CID 9080124) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-acetyl-N-cyclopropylthiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-cyclopropylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 9080124 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-acetyl-N-cyclopropylthiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)NC2CC2)s1 |
| InChI | InChI=1S/C10H11NO2S/c1-6(12)8-4-5-9(14-8)10(13)11-7-2-3-7/h4-5,7H,2-3H2,1H3,(H,11,13) |
| InChIKey | OSUPUNMZTKDMLE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |