C20H21Br2N — CID 90801261
3-(5,14-dibromo-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N,N-dimethylpropan-1-amine (PubChem CID 90801261) has the molecular formula C20H21Br2N and a molecular weight of 435.20 g/mol. Its IUPAC name is 3-(5,14-dibromo-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5,14-dibromo-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 90801261 |
| Molecular Formula | C20H21Br2N |
| Molecular Weight | 435.20 g/mol |
| Exact Mass | 433.00 |
| IUPAC Name | 3-(5,14-dibromo-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC=C1c2cc(Br)ccc2CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C20H21Br2N/c1-23(2)11-3-4-18-19-12-16(21)9-7-14(19)5-6-15-8-10-17(22)13-20(15)18/h4,7-10,12-13H,3,5-6,11H2,1-2H3 |
| InChIKey | XDFKQAADHCJIEA-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.20 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|