About [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate
[(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate (PubChem CID 90801381) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate |
| PubChem CID | 90801381 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C8H17NO4/c1-8(2,3)9-7(12)13-5-6(11)4-10/h6,10-11H,4-5H2,1-3H3,(H,9,12)/t6-/m1/s1 |
| InChIKey | ZOZJKNXSDMERRB-ZCFIWIBFSA-N |
| XLogP | -0.14 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate?
The IUPAC name of [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate (CID 90801381) is [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate.
What is the SMILES notation for [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate?
The canonical SMILES for [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC[C@H](O)CO.
What is the InChIKey of [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate?
The InChIKey is ZOZJKNXSDMERRB-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H17NO4/c1-8(2,3)9-7(12)13-5-6(11)4-10/h6,10-11H,4-5H2,1-3H3,(H,9,12)/t6-/m1/s1.
What are the key properties of [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate?
[(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate has a molecular weight of 191.23 g/mol, XLogP of -0.14, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,3-dihydroxypropyl] N-tert-butylcarbamate is sourced from PubChem (CID 90801381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).