C29H27F5N2O — CID 90801528
N-[(3aS,4S,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-bis(4-fluorophenyl)acetamide (PubChem CID 90801528) has the molecular formula C29H27F5N2O and a molecular weight of 514.54 g/mol. Its IUPAC name is N-[(3aS,4S,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-bis(4-fluorophenyl)acetamide.
| Compound Name | N-[(3aS,4S,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-bis(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 90801528 |
| Molecular Formula | C29H27F5N2O |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | N-[(3aS,4S,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-2,2-bis(4-fluorophenyl)acetamide |
| SMILES | O=C(N[C@H]1CC[C@@H]2CN(Cc3cccc(C(F)(F)F)c3)C[C@H]21)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H27F5N2O/c30-23-9-4-19(5-10-23)27(20-6-11-24(31)12-7-20)28(37)35-26-13-8-21-16-36(17-25(21)26)15-18-2-1-3-22(14-18)29(32,33)34/h1-7,9-12,14,21,25-27H,8,13,15-17H2,(H,35,37)/t21-,25-,26+/m1/s1 |
| InChIKey | AVKCVRJFBPWNND-QGDZQMKYSA-N |
| XLogP | 6.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |