C19H31F10N3O2 — CID 90801681
1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine (PubChem CID 90801681) has the molecular formula C19H31F10N3O2 and a molecular weight of 523.46 g/mol. Its IUPAC name is 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine.
| Compound Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine |
|---|---|
| PubChem CID | 90801681 |
| Molecular Formula | C19H31F10N3O2 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-(3-ethoxy-1,1,2,2,3,3-hexafluoropropyl)-4-methylpiperidine;1-methyl-4-(1,1,2,2-tetrafluoro-2-methoxyethyl)piperazine |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)N1CCC(C)CC1.COC(F)(F)C(F)(F)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H17F6NO.C8H14F4N2O/c1-3-19-11(16,17)9(12,13)10(14,15)18-6-4-8(2)5-7-18;1-13-3-5-14(6-4-13)7(9,10)8(11,12)15-2/h8H,3-7H2,1-2H3;3-6H2,1-2H3 |
| InChIKey | GPXKAXIZTFHIMP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|