About 4-tert-butyl-1-(3,3-dimethylbutyl)triazole
4-tert-butyl-1-(3,3-dimethylbutyl)triazole (PubChem CID 90801752) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 4-tert-butyl-1-(3,3-dimethylbutyl)triazole.
Molecular Properties
| Compound Name | 4-tert-butyl-1-(3,3-dimethylbutyl)triazole |
| PubChem CID | 90801752 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 4-tert-butyl-1-(3,3-dimethylbutyl)triazole |
| SMILES | CC(C)(C)CCn1cc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C12H23N3/c1-11(2,3)7-8-15-9-10(13-14-15)12(4,5)6/h9H,7-8H2,1-6H3 |
| InChIKey | FTYLRYZLUMDULE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-1-(3,3-dimethylbutyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-(3,3-dimethylbutyl)triazole?
The IUPAC name of 4-tert-butyl-1-(3,3-dimethylbutyl)triazole (CID 90801752) is 4-tert-butyl-1-(3,3-dimethylbutyl)triazole.
What is the SMILES notation for 4-tert-butyl-1-(3,3-dimethylbutyl)triazole?
The canonical SMILES for 4-tert-butyl-1-(3,3-dimethylbutyl)triazole is CC(C)(C)CCn1cc(C(C)(C)C)nn1.
What is the InChIKey of 4-tert-butyl-1-(3,3-dimethylbutyl)triazole?
The InChIKey is FTYLRYZLUMDULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-11(2,3)7-8-15-9-10(13-14-15)12(4,5)6/h9H,7-8H2,1-6H3.
What are the key properties of 4-tert-butyl-1-(3,3-dimethylbutyl)triazole?
4-tert-butyl-1-(3,3-dimethylbutyl)triazole has a molecular weight of 209.34 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-(3,3-dimethylbutyl)triazole is sourced from PubChem (CID 90801752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).