About (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide
(2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 9080199) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| PubChem CID | 9080199 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H13NO2/c14-12(13-9-5-6-9)11-7-8-3-1-2-4-10(8)15-11/h1-4,9,11H,5-7H2,(H,13,14)/t11-/m0/s1 |
| InChIKey | INJJPMVTXQLBKF-NSHDSACASA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide?
The IUPAC name of (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide (CID 9080199) is (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide.
What is the SMILES notation for (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide?
The canonical SMILES for (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide is O=C(NC1CC1)[C@@H]1Cc2ccccc2O1.
What is the InChIKey of (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide?
The InChIKey is INJJPMVTXQLBKF-NSHDSACASA-N. The full InChI is InChI=1S/C12H13NO2/c14-12(13-9-5-6-9)11-7-8-3-1-2-4-10(8)15-11/h1-4,9,11H,5-7H2,(H,13,14)/t11-/m0/s1.
What are the key properties of (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide?
(2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide has a molecular weight of 203.24 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-cyclopropyl-2,3-dihydro-1-benzofuran-2-carboxamide is sourced from PubChem (CID 9080199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).