About 4-methyl-2,1,3-benzoxadiazole;propane
4-methyl-2,1,3-benzoxadiazole;propane (PubChem CID 90802808) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-methyl-2,1,3-benzoxadiazole;propane.
Molecular Properties
| Compound Name | 4-methyl-2,1,3-benzoxadiazole;propane |
| PubChem CID | 90802808 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-methyl-2,1,3-benzoxadiazole;propane |
| SMILES | CCC.Cc1cccc2nonc12 |
| InChI | InChI=1S/C7H6N2O.C3H8/c1-5-3-2-4-6-7(5)9-10-8-6;1-3-2/h2-4H,1H3;3H2,1-2H3 |
| InChIKey | HWDNZVPZMJBMKL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,1,3-benzoxadiazole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,1,3-benzoxadiazole;propane?
The IUPAC name of 4-methyl-2,1,3-benzoxadiazole;propane (CID 90802808) is 4-methyl-2,1,3-benzoxadiazole;propane.
What is the SMILES notation for 4-methyl-2,1,3-benzoxadiazole;propane?
The canonical SMILES for 4-methyl-2,1,3-benzoxadiazole;propane is CCC.Cc1cccc2nonc12.
What is the InChIKey of 4-methyl-2,1,3-benzoxadiazole;propane?
The InChIKey is HWDNZVPZMJBMKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O.C3H8/c1-5-3-2-4-6-7(5)9-10-8-6;1-3-2/h2-4H,1H3;3H2,1-2H3.
What are the key properties of 4-methyl-2,1,3-benzoxadiazole;propane?
4-methyl-2,1,3-benzoxadiazole;propane has a molecular weight of 178.23 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,1,3-benzoxadiazole;propane is sourced from PubChem (CID 90802808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).