About [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate
[4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate (PubChem CID 90802902) has the molecular formula C27H24N4O2
and a molecular weight of 436.52 g/mol. Its IUPAC name is [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate |
| PubChem CID | 90802902 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCc1ccc(-c2nc3ccnc(C#N)c3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-27(2,3)31-26(32)33-17-18-9-11-20(12-10-18)25-21(19-7-5-4-6-8-19)15-22-23(30-25)13-14-29-24(22)16-28/h4-15H,17H2,1-3H3,(H,31,32) |
| InChIKey | WQOVNJFPXVYEJB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate?
The IUPAC name of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate (CID 90802902) is [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate.
What is the SMILES notation for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate?
The canonical SMILES for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCc1ccc(-c2nc3ccnc(C#N)c3cc2-c2ccccc2)cc1.
What is the InChIKey of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate?
The InChIKey is WQOVNJFPXVYEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N4O2/c1-27(2,3)31-26(32)33-17-18-9-11-20(12-10-18)25-21(19-7-5-4-6-8-19)15-22-23(30-25)13-14-29-24(22)16-28/h4-15H,17H2,1-3H3,(H,31,32).
What are the key properties of [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate?
[4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate has a molecular weight of 436.52 g/mol, XLogP of 5.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5-cyano-3-phenyl-1,6-naphthyridin-2-yl)phenyl]methyl N-tert-butylcarbamate is sourced from PubChem (CID 90802902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).