About N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine
N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine (PubChem CID 90803145) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine.
Molecular Properties
| Compound Name | N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine |
| PubChem CID | 90803145 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine |
| SMILES | CC=CC(C)(C)C=C/N=C(\C)CC |
| InChI | InChI=1S/C12H21N/c1-6-8-12(4,5)9-10-13-11(3)7-2/h6,8-10H,7H2,1-5H3/b8-6?,10-9?,13-11+ |
| InChIKey | KZFLSBATCLTGDK-GGPJBOOXSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine?
The IUPAC name of N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine (CID 90803145) is N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine.
What is the SMILES notation for N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine?
The canonical SMILES for N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine is CC=CC(C)(C)C=C/N=C(\C)CC.
What is the InChIKey of N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine?
The InChIKey is KZFLSBATCLTGDK-GGPJBOOXSA-N. The full InChI is InChI=1S/C12H21N/c1-6-8-12(4,5)9-10-13-11(3)7-2/h6,8-10H,7H2,1-5H3/b8-6?,10-9?,13-11+.
What are the key properties of N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine?
N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine has a molecular weight of 179.31 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-dimethylhexa-1,4-dienyl)butan-2-imine is sourced from PubChem (CID 90803145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).