C26H34N2O4S — CID 90803216
N-[4,5-dimethyl-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-methylbenzenesulfonamide;ethane (PubChem CID 90803216) has the molecular formula C26H34N2O4S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[4,5-dimethyl-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-methylbenzenesulfonamide;ethane.
| Compound Name | N-[4,5-dimethyl-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-methylbenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 90803216 |
| Molecular Formula | C26H34N2O4S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N-[4,5-dimethyl-2-(2-methyl-1-oxidopyridin-1-ium-3-carbonyl)phenyl]-4-methylbenzenesulfonamide;ethane |
| SMILES | CC.CC.Cc1ccc(S(=O)(=O)Nc2cc(C)c(C)cc2C(=O)c2ccc[n+]([O-])c2C)cc1 |
| InChI | InChI=1S/C22H22N2O4S.2C2H6/c1-14-7-9-18(10-8-14)29(27,28)23-21-13-16(3)15(2)12-20(21)22(25)19-6-5-11-24(26)17(19)4;2*1-2/h5-13,23H,1-4H3;2*1-2H3 |
| InChIKey | WPMOGNWOLDPGGV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|