About 4-(sulfanylmethyl)pentane-1,1,5-trithiol
4-(sulfanylmethyl)pentane-1,1,5-trithiol (PubChem CID 90803732) has the molecular formula C6H14S4
and a molecular weight of 214.45 g/mol. Its IUPAC name is 4-(sulfanylmethyl)pentane-1,1,5-trithiol.
Molecular Properties
| Compound Name | 4-(sulfanylmethyl)pentane-1,1,5-trithiol |
| PubChem CID | 90803732 |
| Molecular Formula | C6H14S4 |
| Molecular Weight | 214.45 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 4-(sulfanylmethyl)pentane-1,1,5-trithiol |
| SMILES | SCC(CS)CCC(S)S |
| InChI | InChI=1S/C6H14S4/c7-3-5(4-8)1-2-6(9)10/h5-10H,1-4H2 |
| InChIKey | OXQUYLZBGPWIGB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(sulfanylmethyl)pentane-1,1,5-trithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(sulfanylmethyl)pentane-1,1,5-trithiol?
The IUPAC name of 4-(sulfanylmethyl)pentane-1,1,5-trithiol (CID 90803732) is 4-(sulfanylmethyl)pentane-1,1,5-trithiol.
What is the SMILES notation for 4-(sulfanylmethyl)pentane-1,1,5-trithiol?
The canonical SMILES for 4-(sulfanylmethyl)pentane-1,1,5-trithiol is SCC(CS)CCC(S)S.
What is the InChIKey of 4-(sulfanylmethyl)pentane-1,1,5-trithiol?
The InChIKey is OXQUYLZBGPWIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S4/c7-3-5(4-8)1-2-6(9)10/h5-10H,1-4H2.
What are the key properties of 4-(sulfanylmethyl)pentane-1,1,5-trithiol?
4-(sulfanylmethyl)pentane-1,1,5-trithiol has a molecular weight of 214.45 g/mol, XLogP of 2.43, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(sulfanylmethyl)pentane-1,1,5-trithiol is sourced from PubChem (CID 90803732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).