C14H14INO5 — CID 90803851
(2S,4aR)-4-(2-iodobenzoyl)-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one (PubChem CID 90803851) has the molecular formula C14H14INO5 and a molecular weight of 403.17 g/mol. Its IUPAC name is (2S,4aR)-4-(2-iodobenzoyl)-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one.
| Compound Name | (2S,4aR)-4-(2-iodobenzoyl)-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 90803851 |
| Molecular Formula | C14H14INO5 |
| Molecular Weight | 403.17 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | (2S,4aR)-4-(2-iodobenzoyl)-2-methoxy-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
| SMILES | CO[C@@H]1CN(C(=O)c2ccccc2I)[C@H]2C(=O)OCC2O1 |
| InChI | InChI=1S/C14H14INO5/c1-19-11-6-16(12-10(21-11)7-20-14(12)18)13(17)8-4-2-3-5-9(8)15/h2-5,10-12H,6-7H2,1H3/t10?,11-,12+/m0/s1 |
| InChIKey | XRVSNXFLNLXKHW-GLXQMMQGSA-N |
| XLogP | 1.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|