C22H45NO — CID 90803890
11-(diethylamino)-7-ethyl-4,4,9,9-tetramethyldodec-6-en-2-ol (PubChem CID 90803890) has the molecular formula C22H45NO and a molecular weight of 339.61 g/mol. Its IUPAC name is 11-(diethylamino)-7-ethyl-4,4,9,9-tetramethyldodec-6-en-2-ol.
| Compound Name | 11-(diethylamino)-7-ethyl-4,4,9,9-tetramethyldodec-6-en-2-ol |
|---|---|
| PubChem CID | 90803890 |
| Molecular Formula | C22H45NO |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.35 |
| IUPAC Name | 11-(diethylamino)-7-ethyl-4,4,9,9-tetramethyldodec-6-en-2-ol |
| SMILES | CCC(=CCC(C)(C)CC(C)O)CC(C)(C)CC(C)N(CC)CC |
| InChI | InChI=1S/C22H45NO/c1-10-20(13-14-21(6,7)16-19(5)24)17-22(8,9)15-18(4)23(11-2)12-3/h13,18-19,24H,10-12,14-17H2,1-9H3 |
| InChIKey | OLBTZWUTTWCNOK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|