C16H16BrN3O3 — CID 9080395
2-(3-bromoanilino)-N-(4,5-dimethyl-2-nitrophenyl)acetamide (PubChem CID 9080395) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is 2-(3-bromoanilino)-N-(4,5-dimethyl-2-nitrophenyl)acetamide.
| Compound Name | 2-(3-bromoanilino)-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9080395 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 2-(3-bromoanilino)-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
| SMILES | Cc1cc(NC(=O)CNc2cccc(Br)c2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H16BrN3O3/c1-10-6-14(15(20(22)23)7-11(10)2)19-16(21)9-18-13-5-3-4-12(17)8-13/h3-8,18H,9H2,1-2H3,(H,19,21) |
| InChIKey | DSZJQGLFRUGFMH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|