C19H13BrF2N2 — CID 90804440
(6'-bromo-7,8-difluorospiro[2,5-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide (PubChem CID 90804440) has the molecular formula C19H13BrF2N2 and a molecular weight of 387.23 g/mol. Its IUPAC name is (6'-bromo-7,8-difluorospiro[2,5-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide.
| Compound Name | (6'-bromo-7,8-difluorospiro[2,5-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide |
|---|---|
| PubChem CID | 90804440 |
| Molecular Formula | C19H13BrF2N2 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (6'-bromo-7,8-difluorospiro[2,5-dihydro-1H-naphthalene-3,2'-3H-indene]-1'-ylidene)cyanamide |
| SMILES | N#C/N=C1\c2cc(Br)ccc2CC12C=C1CC=C(F)C(F)=C1CC2 |
| InChI | InChI=1S/C19H13BrF2N2/c20-13-3-1-12-9-19(18(24-10-23)15(12)7-13)6-5-14-11(8-19)2-4-16(21)17(14)22/h1,3-4,7-8H,2,5-6,9H2/b24-18+ |
| InChIKey | ZSTLKVOKOAULAE-HKOYGPOVSA-N |
| XLogP | 5.46 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|