About 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane
10-(3,3-dimethylcyclohexyl)spiro[4.5]decane (PubChem CID 90804483) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane.
Molecular Properties
| Compound Name | 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane |
| PubChem CID | 90804483 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane |
| SMILES | CC1(C)CCCC(C2CCCCC23CCCC3)C1 |
| InChI | InChI=1S/C18H32/c1-17(2)10-7-8-15(14-17)16-9-3-4-11-18(16)12-5-6-13-18/h15-16H,3-14H2,1-2H3 |
| InChIKey | AEEAIQKROVIZIL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane?
The IUPAC name of 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane (CID 90804483) is 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane.
What is the SMILES notation for 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane?
The canonical SMILES for 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane is CC1(C)CCCC(C2CCCCC23CCCC3)C1.
What is the InChIKey of 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane?
The InChIKey is AEEAIQKROVIZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32/c1-17(2)10-7-8-15(14-17)16-9-3-4-11-18(16)12-5-6-13-18/h15-16H,3-14H2,1-2H3.
What are the key properties of 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane?
10-(3,3-dimethylcyclohexyl)spiro[4.5]decane has a molecular weight of 248.45 g/mol, XLogP of 5.95, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3,3-dimethylcyclohexyl)spiro[4.5]decane is sourced from PubChem (CID 90804483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).