C23H21F3N2O3 — CID 90804965
1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid (PubChem CID 90804965) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid.
| Compound Name | 1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid |
|---|---|
| PubChem CID | 90804965 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 1'-[3-[2-(trifluoromethyl)phenyl]prop-2-enoyl]spiro[1,2-dihydroindole-3,4'-piperidine]-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C1(CCN(C(=O)C=Cc3ccccc3C(F)(F)F)CC1)CN2 |
| InChI | InChI=1S/C23H21F3N2O3/c24-23(25,26)17-4-2-1-3-15(17)6-8-20(29)28-11-9-22(10-12-28)14-27-19-7-5-16(21(30)31)13-18(19)22/h1-8,13,27H,9-12,14H2,(H,30,31) |
| InChIKey | JSINFGFHMIHEPK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|