C15H20N2O4 — CID 90805518
ethyl 2-amino-2-oxoacetate;2-isocyanato-1,3,4,5-tetramethylbenzene (PubChem CID 90805518) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is ethyl 2-amino-2-oxoacetate;2-isocyanato-1,3,4,5-tetramethylbenzene.
| Compound Name | ethyl 2-amino-2-oxoacetate;2-isocyanato-1,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 90805518 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | ethyl 2-amino-2-oxoacetate;2-isocyanato-1,3,4,5-tetramethylbenzene |
| SMILES | CCOC(=O)C(N)=O.Cc1cc(C)c(N=C=O)c(C)c1C |
| InChI | InChI=1S/C11H13NO.C4H7NO3/c1-7-5-8(2)11(12-6-13)10(4)9(7)3;1-2-8-4(7)3(5)6/h5H,1-4H3;2H2,1H3,(H2,5,6) |
| InChIKey | OUKNPYRDOLKSIV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|