C23H20BrNO3 — CID 90805913
methyl (2R)-2-[(4-bromo-2-phenylbenzoyl)amino]-3-phenylpropanoate (PubChem CID 90805913) has the molecular formula C23H20BrNO3 and a molecular weight of 438.32 g/mol. Its IUPAC name is methyl (2R)-2-[(4-bromo-2-phenylbenzoyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2R)-2-[(4-bromo-2-phenylbenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 90805913 |
| Molecular Formula | C23H20BrNO3 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | methyl (2R)-2-[(4-bromo-2-phenylbenzoyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@@H](Cc1ccccc1)NC(=O)c1ccc(Br)cc1-c1ccccc1 |
| InChI | InChI=1S/C23H20BrNO3/c1-28-23(27)21(14-16-8-4-2-5-9-16)25-22(26)19-13-12-18(24)15-20(19)17-10-6-3-7-11-17/h2-13,15,21H,14H2,1H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | UUBUMAVPWXXQIL-OAQYLSRUSA-N |
| XLogP | 4.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |