C25H20N2O3 — CID 90806004
7-[(1S,7R)-3,5-dihydroxy-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-methyl-1H-quinolin-2-one (PubChem CID 90806004) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 7-[(1S,7R)-3,5-dihydroxy-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-methyl-1H-quinolin-2-one.
| Compound Name | 7-[(1S,7R)-3,5-dihydroxy-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90806004 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 7-[(1S,7R)-3,5-dihydroxy-8-phenyl-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-4-methyl-1H-quinolin-2-one |
| SMILES | Cc1cc(=O)[nH]c2cc(-n3c(O)c4c(c3O)[C@@H]3C[C@H]4C=C3c3ccccc3)ccc12 |
| InChI | InChI=1S/C25H20N2O3/c1-13-9-21(28)26-20-12-16(7-8-17(13)20)27-24(29)22-15-10-18(14-5-3-2-4-6-14)19(11-15)23(22)25(27)30/h2-10,12,15,19,29-30H,11H2,1H3,(H,26,28)/t15-,19-/m1/s1 |
| InChIKey | NJQSWDISUMBYHA-DNVCBOLYSA-N |
| XLogP | 4.71 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |