C25H24F2O5S — CID 90806117
tert-butyl 2-[2-[2-fluoro-4-(4-fluorophenyl)sulfonylphenyl]-4-methylphenoxy]acetate (PubChem CID 90806117) has the molecular formula C25H24F2O5S and a molecular weight of 474.53 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-fluoro-4-(4-fluorophenyl)sulfonylphenyl]-4-methylphenoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-fluoro-4-(4-fluorophenyl)sulfonylphenyl]-4-methylphenoxy]acetate |
|---|---|
| PubChem CID | 90806117 |
| Molecular Formula | C25H24F2O5S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | tert-butyl 2-[2-[2-fluoro-4-(4-fluorophenyl)sulfonylphenyl]-4-methylphenoxy]acetate |
| SMILES | Cc1ccc(OCC(=O)OC(C)(C)C)c(-c2ccc(S(=O)(=O)c3ccc(F)cc3)cc2F)c1 |
| InChI | InChI=1S/C25H24F2O5S/c1-16-5-12-23(31-15-24(28)32-25(2,3)4)21(13-16)20-11-10-19(14-22(20)27)33(29,30)18-8-6-17(26)7-9-18/h5-14H,15H2,1-4H3 |
| InChIKey | YYJNJAVNWLWCKL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |