C24H31N3O3S — CID 90806435
[5-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]-2-pyridinyl]sulfanyl butanoate (PubChem CID 90806435) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is [5-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]-2-pyridinyl]sulfanyl butanoate.
| Compound Name | [5-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]-2-pyridinyl]sulfanyl butanoate |
|---|---|
| PubChem CID | 90806435 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [5-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]-2-pyridinyl]sulfanyl butanoate |
| SMILES | CCCC(=O)OSc1ccc(C(=O)N2CCN(c3ccccc3C(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C24H31N3O3S/c1-5-8-22(28)30-31-21-12-11-18(17-25-21)23(29)27-15-13-26(14-16-27)20-10-7-6-9-19(20)24(2,3)4/h6-7,9-12,17H,5,8,13-16H2,1-4H3 |
| InChIKey | IHTDODWTQSFFDB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|