C38H34N4S2 — CID 90806445
3-(5-butylsulfanylthiophen-2-yl)-6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridine (PubChem CID 90806445) has the molecular formula C38H34N4S2 and a molecular weight of 610.85 g/mol. Its IUPAC name is 3-(5-butylsulfanylthiophen-2-yl)-6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-(5-butylsulfanylthiophen-2-yl)-6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 90806445 |
| Molecular Formula | C38H34N4S2 |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 3-(5-butylsulfanylthiophen-2-yl)-6-(3-methyl-1-tritylpyrazol-4-yl)imidazo[1,2-a]pyridine |
| SMILES | CCCCSc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4C)cn23)s1 |
| InChI | InChI=1S/C38H34N4S2/c1-3-4-24-43-37-23-21-35(44-37)34-25-39-36-22-20-29(26-41(34)36)33-27-42(40-28(33)2)38(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-23,25-27H,3-4,24H2,1-2H3 |
| InChIKey | ATEJAOGFLQRVLH-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|