About 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine
13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine (PubChem CID 90806516) has the molecular formula C11H25N3S2
and a molecular weight of 263.48 g/mol. Its IUPAC name is 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine.
Molecular Properties
| Compound Name | 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine |
| PubChem CID | 90806516 |
| Molecular Formula | C11H25N3S2 |
| Molecular Weight | 263.48 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine |
| SMILES | CC1(N)CSCCNCCCNCCSC1 |
| InChI | InChI=1S/C11H25N3S2/c1-11(12)9-15-7-5-13-3-2-4-14-6-8-16-10-11/h13-14H,2-10,12H2,1H3 |
| InChIKey | JCKIRSQSNHVMJT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine?
The IUPAC name of 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine (CID 90806516) is 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine.
What is the SMILES notation for 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine?
The canonical SMILES for 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine is CC1(N)CSCCNCCCNCCSC1.
What is the InChIKey of 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine?
The InChIKey is JCKIRSQSNHVMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3S2/c1-11(12)9-15-7-5-13-3-2-4-14-6-8-16-10-11/h13-14H,2-10,12H2,1H3.
What are the key properties of 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine?
13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine has a molecular weight of 263.48 g/mol, XLogP of 0.75, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 13-methyl-1,11-dithia-4,8-diazacyclotetradecan-13-amine is sourced from PubChem (CID 90806516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).