C29H36N4O7 — CID 90806888
5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[(4-cyclopentyloxy-6-phenylpyridine-2-carbonyl)amino]pentanedioate (PubChem CID 90806888) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[(4-cyclopentyloxy-6-phenylpyridine-2-carbonyl)amino]pentanedioate.
| Compound Name | 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[(4-cyclopentyloxy-6-phenylpyridine-2-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 90806888 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[(4-cyclopentyloxy-6-phenylpyridine-2-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1cc(OC2CCCC2)cc(-c2ccccc2)n1)C(=O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C29H36N4O7/c1-2-38-26(34)13-12-23(28(36)40-29(37)33-16-14-30-15-17-33)32-27(35)25-19-22(39-21-10-6-7-11-21)18-24(31-25)20-8-4-3-5-9-20/h3-5,8-9,18-19,21,23,30H,2,6-7,10-17H2,1H3,(H,32,35) |
| InChIKey | VGTFRWYWUUNUPK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 136.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|