C31H34F10O5 — CID 90807549
(4S)-4-hydroxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pent-1-enyl]phenyl]pentan-3-yl]phenoxy]pentanoic acid (PubChem CID 90807549) has the molecular formula C31H34F10O5 and a molecular weight of 676.59 g/mol. Its IUPAC name is (4S)-4-hydroxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pent-1-enyl]phenyl]pentan-3-yl]phenoxy]pentanoic acid.
| Compound Name | (4S)-4-hydroxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pent-1-enyl]phenyl]pentan-3-yl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 90807549 |
| Molecular Formula | C31H34F10O5 |
| Molecular Weight | 676.59 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | (4S)-4-hydroxy-5-[2-methyl-4-[3-[3-methyl-4-[4,4,5,5,5-pentafluoro-3-hydroxy-3-(1,1,2,2,2-pentafluoroethyl)pent-1-enyl]phenyl]pentan-3-yl]phenoxy]pentanoic acid |
| SMILES | CCC(CC)(c1ccc(C=CC(O)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)c(C)c1)c1ccc(OC[C@@H](O)CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C31H34F10O5/c1-5-26(6-2,22-9-11-24(19(4)16-22)46-17-23(42)10-12-25(43)44)21-8-7-20(18(3)15-21)13-14-27(45,28(32,33)30(36,37)38)29(34,35)31(39,40)41/h7-9,11,13-16,23,42,45H,5-6,10,12,17H2,1-4H3,(H,43,44)/t23-/m0/s1 |
| InChIKey | ZWYQJOXZQMTJED-QHCPKHFHSA-N |
| XLogP | 8.15 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.59 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|