C10H13N3 — CID 90807757
1-(5,7-dimethyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-1-ethenylhydrazine (PubChem CID 90807757) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(5,7-dimethyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-1-ethenylhydrazine.
| Compound Name | 1-(5,7-dimethyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-1-ethenylhydrazine |
|---|---|
| PubChem CID | 90807757 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(5,7-dimethyl-1-azacyclohepta-1,3,5,6-tetraen-2-yl)-1-ethenylhydrazine |
| SMILES | C=CN(N)C1=NC(C)=C=C(C)C=C1 |
| InChI | InChI=1S/C10H13N3/c1-4-13(11)10-6-5-8(2)7-9(3)12-10/h4-6H,1,11H2,2-3H3 |
| InChIKey | YBZCRJQLYIEKSI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|