About propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate
propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate (PubChem CID 90807761) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate.
Analyze propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate?
The IUPAC name of propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate (CID 90807761) is propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate.
What is the SMILES notation for propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate?
The canonical SMILES for propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate is CCCOC(=O)N1CC2CC3CC1CN(C3)C2.
What is the InChIKey of propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate?
The InChIKey is DBVMKXIEDPPLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-2-3-17-13(16)15-8-11-4-10-5-12(15)9-14(6-10)7-11/h10-12H,2-9H2,1H3.
What are the key properties of propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate?
propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1,4-diazatricyclo[4.3.1.13,8]undecane-4-carboxylate is sourced from PubChem (CID 90807761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).