C25H25N3O3 — CID 90808315
(2E)-2-[4,5-dimethyl-2-[2-(6-phenoxy-2-pyridinyl)ethynyl]cyclohexa-1,4-dien-1-yl]-2-methoxyimino-N-methylacetamide (PubChem CID 90808315) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2E)-2-[4,5-dimethyl-2-[2-(6-phenoxy-2-pyridinyl)ethynyl]cyclohexa-1,4-dien-1-yl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[4,5-dimethyl-2-[2-(6-phenoxy-2-pyridinyl)ethynyl]cyclohexa-1,4-dien-1-yl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 90808315 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2E)-2-[4,5-dimethyl-2-[2-(6-phenoxy-2-pyridinyl)ethynyl]cyclohexa-1,4-dien-1-yl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)C1=C(C#Cc2cccc(Oc3ccccc3)n2)CC(C)=C(C)C1 |
| InChI | InChI=1S/C25H25N3O3/c1-17-15-19(22(16-18(17)2)24(28-30-4)25(29)26-3)13-14-20-9-8-12-23(27-20)31-21-10-6-5-7-11-21/h5-12H,15-16H2,1-4H3,(H,26,29)/b28-24+ |
| InChIKey | RPKOLGXDPXCZTN-ZZIIXHQDSA-N |
| XLogP | 4.40 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|