About 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid
4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid (PubChem CID 90809057) has the molecular formula C18H8O10
and a molecular weight of 384.25 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid |
| PubChem CID | 90809057 |
| Molecular Formula | C18H8O10 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)OC(=O)c2cccc3c2C(=O)OC3=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H8O10/c19-13(20)7-4-5-8(11(6-7)14(21)22)15(23)27-16(24)9-2-1-3-10-12(9)18(26)28-17(10)25/h1-6H,(H,19,20)(H,21,22) |
| InChIKey | QAEOZOQKAJWNMH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid (CID 90809057) is 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid is O=C(O)c1ccc(C(=O)OC(=O)c2cccc3c2C(=O)OC3=O)c(C(=O)O)c1.
What is the InChIKey of 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid?
The InChIKey is QAEOZOQKAJWNMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8O10/c19-13(20)7-4-5-8(11(6-7)14(21)22)15(23)27-16(24)9-2-1-3-10-12(9)18(26)28-17(10)25/h1-6H,(H,19,20)(H,21,22).
What are the key properties of 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid?
4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid has a molecular weight of 384.25 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxo-2-benzofuran-4-carbonyl)oxycarbonylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 90809057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).