C21H28FN3O6 — CID 90809446
2-[3-[4-(5-fluoro-2-hydroxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol (PubChem CID 90809446) has the molecular formula C21H28FN3O6 and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-[3-[4-(5-fluoro-2-hydroxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol.
| Compound Name | 2-[3-[4-(5-fluoro-2-hydroxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
|---|---|
| PubChem CID | 90809446 |
| Molecular Formula | C21H28FN3O6 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[3-[4-(5-fluoro-2-hydroxyphenyl)piperazin-1-yl]-2-hydroxypropyl]-4,5,6,7-tetrahydroisoindole-1,3,5,6-tetrol |
| SMILES | Oc1ccc(F)cc1N1CCN(CC(O)Cn2c(O)c3c(c2O)CC(O)C(O)C3)CC1 |
| InChI | InChI=1S/C21H28FN3O6/c22-12-1-2-17(27)16(7-12)24-5-3-23(4-6-24)10-13(26)11-25-20(30)14-8-18(28)19(29)9-15(14)21(25)31/h1-2,7,13,18-19,26-31H,3-6,8-11H2 |
| InChIKey | UXLYARLQVDTXOM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |