C19H33N3O3 — CID 90809835
5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-3,3,5-trimethyl-N-(propan-2-ylideneamino)hexanamide (PubChem CID 90809835) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-3,3,5-trimethyl-N-(propan-2-ylideneamino)hexanamide.
| Compound Name | 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-3,3,5-trimethyl-N-(propan-2-ylideneamino)hexanamide |
|---|---|
| PubChem CID | 90809835 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 5-(2,5-dihydroxy-3-propan-2-ylpyrrol-1-yl)-3,3,5-trimethyl-N-(propan-2-ylideneamino)hexanamide |
| SMILES | CC(C)=NNC(=O)CC(C)(C)CC(C)(C)n1c(O)cc(C(C)C)c1O |
| InChI | InChI=1S/C19H33N3O3/c1-12(2)14-9-16(24)22(17(14)25)19(7,8)11-18(5,6)10-15(23)21-20-13(3)4/h9,12,24-25H,10-11H2,1-8H3,(H,21,23) |
| InChIKey | JIAPDMHNUCNFQZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|