C47H51NO10 — CID 90810469
5-O-butyl 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 3-O-octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 1-methylheptane-1,3,5-tricarboxylate;butyl prop-2-enoate (PubChem CID 90810469) has the molecular formula C47H51NO10 and a molecular weight of 789.92 g/mol. Its IUPAC name is 5-O-butyl 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 3-O-octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 1-methylheptane-1,3,5-tricarboxylate;butyl prop-2-enoate.
| Compound Name | 5-O-butyl 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 3-O-octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 1-methylheptane-1,3,5-tricarboxylate;butyl prop-2-enoate |
|---|---|
| PubChem CID | 90810469 |
| Molecular Formula | C47H51NO10 |
| Molecular Weight | 789.92 g/mol |
| Exact Mass | 789.35 |
| IUPAC Name | 5-O-butyl 1-O-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] 3-O-octadeca-1,3,5,7,9,11,13,15,17-nonaynyl 1-methylheptane-1,3,5-tricarboxylate;butyl prop-2-enoate |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#COC(=O)C(CC(C)C(=O)OCCNC(=O)OC(C)(C)C)CC(CC)C(=O)OCCCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C40H39NO8.C7H12O2/c1-8-11-13-14-15-16-17-18-19-20-21-22-23-24-25-26-29-47-38(44)35(32-34(10-3)37(43)46-28-12-9-2)31-33(4)36(42)48-30-27-41-39(45)49-40(5,6)7;1-3-5-6-9-7(8)4-2/h1,33-35H,9-10,12,27-28,30-32H2,2-7H3,(H,41,45);4H,2-3,5-6H2,1H3 |
| InChIKey | WNMLAZSBROTPKT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|