C12H10O7 — CID 90810888
5,8-dihydroxy-6,7-dimethoxynaphthalene-1,2,4-trione (PubChem CID 90810888) has the molecular formula C12H10O7 and a molecular weight of 266.20 g/mol. Its IUPAC name is 5,8-dihydroxy-6,7-dimethoxynaphthalene-1,2,4-trione.
| Compound Name | 5,8-dihydroxy-6,7-dimethoxynaphthalene-1,2,4-trione |
|---|---|
| PubChem CID | 90810888 |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 5,8-dihydroxy-6,7-dimethoxynaphthalene-1,2,4-trione |
| SMILES | COc1c(O)c2c(c(O)c1OC)C(=O)C(=O)CC2=O |
| InChI | InChI=1S/C12H10O7/c1-18-11-9(16)6-4(13)3-5(14)8(15)7(6)10(17)12(11)19-2/h16-17H,3H2,1-2H3 |
| InChIKey | CGJRVKNKVCCXHC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|