C16H15N5O6S2 — CID 90811108
2-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethoxy]imino-2-(5-phenyl-2-sulfanyl-2H-1,3,4-oxadiazol-3-yl)acetic acid (PubChem CID 90811108) has the molecular formula C16H15N5O6S2 and a molecular weight of 437.46 g/mol. Its IUPAC name is 2-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethoxy]imino-2-(5-phenyl-2-sulfanyl-2H-1,3,4-oxadiazol-3-yl)acetic acid.
| Compound Name | 2-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethoxy]imino-2-(5-phenyl-2-sulfanyl-2H-1,3,4-oxadiazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 90811108 |
| Molecular Formula | C16H15N5O6S2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-[1-(2-amino-1,3-thiazol-4-yl)-2-methoxy-2-oxoethoxy]imino-2-(5-phenyl-2-sulfanyl-2H-1,3,4-oxadiazol-3-yl)acetic acid |
| SMILES | COC(=O)C(ON=C(C(=O)O)N1N=C(c2ccccc2)OC1S)c1csc(N)n1 |
| InChI | InChI=1S/C16H15N5O6S2/c1-25-14(24)10(9-7-29-15(17)18-9)27-20-11(13(22)23)21-16(28)26-12(19-21)8-5-3-2-4-6-8/h2-7,10,16,28H,1H3,(H2,17,18)(H,22,23) |
| InChIKey | SVTQMSWZMNQGCI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|