C39H31N2O6S2+ — CID 90811797
1,1-dioxo-2-[3-phenyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium (PubChem CID 90811797) has the molecular formula C39H31N2O6S2+ and a molecular weight of 687.82 g/mol. Its IUPAC name is 1,1-dioxo-2-[3-phenyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium.
| Compound Name | 1,1-dioxo-2-[3-phenyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 90811797 |
| Molecular Formula | C39H31N2O6S2+ |
| Molecular Weight | 687.82 g/mol |
| Exact Mass | 687.16 |
| IUPAC Name | 1,1-dioxo-2-[3-phenyl-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate;1-methyl-4-(1-methylpyridin-1-ium-4-yl)pyridin-1-ium |
| SMILES | C[n+]1ccc(-c2cc[n+](C)cc2)cc1.O=C1C(=CC=C(C=CC2=C([O-])c3ccccc3S2(=O)=O)c2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C27H18O6S2.C12H14N2/c28-26-20-10-4-6-12-22(20)34(30,31)24(26)16-14-19(18-8-2-1-3-9-18)15-17-25-27(29)21-11-5-7-13-23(21)35(25,32)33;1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h1-17,28H;3-10H,1-2H3/q;+2/p-1 |
| InChIKey | QJYJYGCGIFQHNZ-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 116.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|